C13H28Cl2O5 — CID 159808869
bis(1-chloro-2,3-dimethoxypropane);2-methyloxirane (PubChem CID 159808869) has the molecular formula C13H28Cl2O5 and a molecular weight of 335.27 g/mol. Its IUPAC name is bis(1-chloro-2,3-dimethoxypropane);2-methyloxirane.
| Compound Name | bis(1-chloro-2,3-dimethoxypropane);2-methyloxirane |
|---|---|
| PubChem CID | 159808869 |
| Molecular Formula | C13H28Cl2O5 |
| Molecular Weight | 335.27 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | bis(1-chloro-2,3-dimethoxypropane);2-methyloxirane |
| SMILES | CC1CO1.COCC(CCl)OC.COCC(CCl)OC |
| InChI | InChI=1S/2C5H11ClO2.C3H6O/c2*1-7-4-5(3-6)8-2;1-3-2-4-3/h2*5H,3-4H2,1-2H3;3H,2H2,1H3 |
| InChIKey | NKTJIDCFMXQEMC-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 49.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.27 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|