About 1-chloro-3-methoxy-2-methylpropane;2-(chloromethyl)oxirane
1-chloro-3-methoxy-2-methylpropane;2-(chloromethyl)oxirane (PubChem CID 160539452) has the molecular formula C8H16Cl2O2
and a molecular weight of 215.12 g/mol. Its IUPAC name is 1-chloro-3-methoxy-2-methylpropane;2-(chloromethyl)oxirane.
Molecular Properties
| Compound Name | 1-chloro-3-methoxy-2-methylpropane;2-(chloromethyl)oxirane |
| PubChem CID | 160539452 |
| Molecular Formula | C8H16Cl2O2 |
| Molecular Weight | 215.12 g/mol |
| Exact Mass | 214.05 |
| IUPAC Name | 1-chloro-3-methoxy-2-methylpropane;2-(chloromethyl)oxirane |
| SMILES | COCC(C)CCl.ClCC1CO1 |
| InChI | InChI=1S/C5H11ClO.C3H5ClO/c1-5(3-6)4-7-2;4-1-3-2-5-3/h5H,3-4H2,1-2H3;3H,1-2H2 |
| InChIKey | QWOZRVZJWWODAC-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.12 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 1-chloro-3-methoxy-2-methylpropane;2-(chloromethyl)oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloro-3-methoxy-2-methylpropane;2-(chloromethyl)oxirane?
The IUPAC name of 1-chloro-3-methoxy-2-methylpropane;2-(chloromethyl)oxirane (CID 160539452) is 1-chloro-3-methoxy-2-methylpropane;2-(chloromethyl)oxirane.
What is the SMILES notation for 1-chloro-3-methoxy-2-methylpropane;2-(chloromethyl)oxirane?
The canonical SMILES for 1-chloro-3-methoxy-2-methylpropane;2-(chloromethyl)oxirane is COCC(C)CCl.ClCC1CO1.
What is the InChIKey of 1-chloro-3-methoxy-2-methylpropane;2-(chloromethyl)oxirane?
The InChIKey is QWOZRVZJWWODAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11ClO.C3H5ClO/c1-5(3-6)4-7-2;4-1-3-2-5-3/h5H,3-4H2,1-2H3;3H,1-2H2.
What are the key properties of 1-chloro-3-methoxy-2-methylpropane;2-(chloromethyl)oxirane?
1-chloro-3-methoxy-2-methylpropane;2-(chloromethyl)oxirane has a molecular weight of 215.12 g/mol, XLogP of 2.13, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloro-3-methoxy-2-methylpropane;2-(chloromethyl)oxirane is sourced from PubChem (CID 160539452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).