About methyl (2R,4S)-2,4,5-trimethoxy-2-(methoxymethyl)pentanoate
methyl (2R,4S)-2,4,5-trimethoxy-2-(methoxymethyl)pentanoate (PubChem CID 100958872) has the molecular formula C11H22O6
and a molecular weight of 250.29 g/mol. Its IUPAC name is methyl (2R,4S)-2,4,5-trimethoxy-2-(methoxymethyl)pentanoate.
Analyze methyl (2R,4S)-2,4,5-trimethoxy-2-(methoxymethyl)pentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2R,4S)-2,4,5-trimethoxy-2-(methoxymethyl)pentanoate?
The IUPAC name of methyl (2R,4S)-2,4,5-trimethoxy-2-(methoxymethyl)pentanoate (CID 100958872) is methyl (2R,4S)-2,4,5-trimethoxy-2-(methoxymethyl)pentanoate.
What is the SMILES notation for methyl (2R,4S)-2,4,5-trimethoxy-2-(methoxymethyl)pentanoate?
The canonical SMILES for methyl (2R,4S)-2,4,5-trimethoxy-2-(methoxymethyl)pentanoate is COC[C@H](C[C@](COC)(OC)C(=O)OC)OC.
What is the InChIKey of methyl (2R,4S)-2,4,5-trimethoxy-2-(methoxymethyl)pentanoate?
The InChIKey is DIKKDDNRYICDRF-GXSJLCMTSA-N. The full InChI is InChI=1S/C11H22O6/c1-13-7-9(15-3)6-11(17-5,8-14-2)10(12)16-4/h9H,6-8H2,1-5H3/t9-,11+/m0/s1.
What are the key properties of methyl (2R,4S)-2,4,5-trimethoxy-2-(methoxymethyl)pentanoate?
methyl (2R,4S)-2,4,5-trimethoxy-2-(methoxymethyl)pentanoate has a molecular weight of 250.29 g/mol, XLogP of 0.24, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2R,4S)-2,4,5-trimethoxy-2-(methoxymethyl)pentanoate is sourced from PubChem (CID 100958872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).