C31H38O3Si2 — CID 134930979
(R)-[(2R,3R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(2-trimethylsilylethynyl)oxiran-2-yl]-phenylmethanol (PubChem CID 134930979) has the molecular formula C31H38O3Si2 and a molecular weight of 514.81 g/mol. Its IUPAC name is (R)-[(2R,3R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(2-trimethylsilylethynyl)oxiran-2-yl]-phenylmethanol.
| Compound Name | (R)-[(2R,3R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(2-trimethylsilylethynyl)oxiran-2-yl]-phenylmethanol |
|---|---|
| PubChem CID | 134930979 |
| Molecular Formula | C31H38O3Si2 |
| Molecular Weight | 514.81 g/mol |
| Exact Mass | 514.24 |
| IUPAC Name | (R)-[(2R,3R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]-2-(2-trimethylsilylethynyl)oxiran-2-yl]-phenylmethanol |
| SMILES | CC(C)(C)[Si](OC[C@H]1O[C@]1(C#C[Si](C)(C)C)[C@H](O)c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H38O3Si2/c1-30(2,3)36(26-18-12-8-13-19-26,27-20-14-9-15-21-27)33-24-28-31(34-28,22-23-35(4,5)6)29(32)25-16-10-7-11-17-25/h7-21,28-29,32H,24H2,1-6H3/t28-,29-,31+/m1/s1 |
| InChIKey | ZEBNNTMMVBQWRR-XQKNLLDYSA-N |
| XLogP | 5.32 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.81 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|