C49H60O8Si — CID 10865690
[(1R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1-[(2S,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]pent-2-ynyl] but-3-enoate (PubChem CID 10865690) has the molecular formula C49H60O8Si and a molecular weight of 805.10 g/mol. Its IUPAC name is [(1R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1-[(2S,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]pent-2-ynyl] but-3-enoate.
| Compound Name | [(1R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1-[(2S,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]pent-2-ynyl] but-3-enoate |
|---|---|
| PubChem CID | 10865690 |
| Molecular Formula | C49H60O8Si |
| Molecular Weight | 805.10 g/mol |
| Exact Mass | 804.41 |
| IUPAC Name | [(1R,4R)-4-[tert-butyl(dimethyl)silyl]oxy-1-[(2S,3R,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]pent-2-ynyl] but-3-enoate |
| SMILES | C=CCC(=O)O[C@H](C#C[C@@H](C)O[Si](C)(C)C(C)(C)C)[C@@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C49H60O8Si/c1-8-21-44(50)55-42(31-30-37(2)57-58(6,7)49(3,4)5)46-48(54-35-41-28-19-12-20-29-41)47(53-34-40-26-17-11-18-27-40)45(52-33-39-24-15-10-16-25-39)43(56-46)36-51-32-38-22-13-9-14-23-38/h8-20,22-29,37,42-43,45-48H,1,21,32-36H2,2-7H3/t37-,42-,43-,45-,46+,47+,48+/m1/s1 |
| InChIKey | VPUSTYHFWNNIOR-GAOUSXADSA-N |
| XLogP | 9.63 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 805.10 |
| LogP ≤ 5 | 9.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|