C40H51NO7 — CID 71817255
N-[(2S)-3-methyl-1-prop-2-enoxybutan-2-yl]-2-[(2R,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(prop-2-enoxymethyl)oxan-2-yl]acetamide (PubChem CID 71817255) has the molecular formula C40H51NO7 and a molecular weight of 657.85 g/mol. Its IUPAC name is N-[(2S)-3-methyl-1-prop-2-enoxybutan-2-yl]-2-[(2R,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(prop-2-enoxymethyl)oxan-2-yl]acetamide.
| Compound Name | N-[(2S)-3-methyl-1-prop-2-enoxybutan-2-yl]-2-[(2R,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(prop-2-enoxymethyl)oxan-2-yl]acetamide |
|---|---|
| PubChem CID | 71817255 |
| Molecular Formula | C40H51NO7 |
| Molecular Weight | 657.85 g/mol |
| Exact Mass | 657.37 |
| IUPAC Name | N-[(2S)-3-methyl-1-prop-2-enoxybutan-2-yl]-2-[(2R,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(prop-2-enoxymethyl)oxan-2-yl]acetamide |
| SMILES | C=CCOC[C@@H](NC(=O)C[C@H]1O[C@H](COCC=C)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1)C(C)C |
| InChI | InChI=1S/C40H51NO7/c1-5-22-43-28-34(30(3)4)41-37(42)24-35-38(45-25-31-16-10-7-11-17-31)40(47-27-33-20-14-9-15-21-33)39(36(48-35)29-44-23-6-2)46-26-32-18-12-8-13-19-32/h5-21,30,34-36,38-40H,1-2,22-29H2,3-4H3,(H,41,42)/t34-,35-,36-,38+,39-,40-/m1/s1 |
| InChIKey | IKBMIUCDNCCVNA-MGOSRKGMSA-N |
| XLogP | 6.45 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.85 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|