C44H51NO7 — CID 71817193
N-[(2S)-1-phenyl-3-prop-2-enoxypropan-2-yl]-2-[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(prop-2-enoxymethyl)oxan-2-yl]acetamide (PubChem CID 71817193) has the molecular formula C44H51NO7 and a molecular weight of 705.89 g/mol. Its IUPAC name is N-[(2S)-1-phenyl-3-prop-2-enoxypropan-2-yl]-2-[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(prop-2-enoxymethyl)oxan-2-yl]acetamide.
| Compound Name | N-[(2S)-1-phenyl-3-prop-2-enoxypropan-2-yl]-2-[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(prop-2-enoxymethyl)oxan-2-yl]acetamide |
|---|---|
| PubChem CID | 71817193 |
| Molecular Formula | C44H51NO7 |
| Molecular Weight | 705.89 g/mol |
| Exact Mass | 705.37 |
| IUPAC Name | N-[(2S)-1-phenyl-3-prop-2-enoxypropan-2-yl]-2-[(2S,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(prop-2-enoxymethyl)oxan-2-yl]acetamide |
| SMILES | C=CCOC[C@H](Cc1ccccc1)NC(=O)C[C@@H]1O[C@H](COCC=C)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C44H51NO7/c1-3-25-47-32-38(27-34-17-9-5-10-18-34)45-41(46)28-39-42(49-29-35-19-11-6-12-20-35)44(51-31-37-23-15-8-16-24-37)43(40(52-39)33-48-26-4-2)50-30-36-21-13-7-14-22-36/h3-24,38-40,42-44H,1-2,25-33H2,(H,45,46)/t38-,39-,40+,42-,43+,44+/m0/s1 |
| InChIKey | YNQVWDZEPUIBDE-QKZAUNRLSA-N |
| XLogP | 7.03 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.89 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|