C31H47IO4Si — CID 134853562
tert-butyl-[(2R,6E,8E)-9-[(4R,6R)-6-[(1S)-3-iodo-1-phenylmethoxyprop-2-ynyl]-2,2-dimethyl-1,3-dioxan-4-yl]nona-6,8-dien-2-yl]oxy-dimethylsilane (PubChem CID 134853562) has the molecular formula C31H47IO4Si and a molecular weight of 638.70 g/mol. Its IUPAC name is tert-butyl-[(2R,6E,8E)-9-[(4R,6R)-6-[(1S)-3-iodo-1-phenylmethoxyprop-2-ynyl]-2,2-dimethyl-1,3-dioxan-4-yl]nona-6,8-dien-2-yl]oxy-dimethylsilane.
| Compound Name | tert-butyl-[(2R,6E,8E)-9-[(4R,6R)-6-[(1S)-3-iodo-1-phenylmethoxyprop-2-ynyl]-2,2-dimethyl-1,3-dioxan-4-yl]nona-6,8-dien-2-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 134853562 |
| Molecular Formula | C31H47IO4Si |
| Molecular Weight | 638.70 g/mol |
| Exact Mass | 638.23 |
| IUPAC Name | tert-butyl-[(2R,6E,8E)-9-[(4R,6R)-6-[(1S)-3-iodo-1-phenylmethoxyprop-2-ynyl]-2,2-dimethyl-1,3-dioxan-4-yl]nona-6,8-dien-2-yl]oxy-dimethylsilane |
| SMILES | C[C@H](CCC/C=C/C=C/[C@H]1C[C@H]([C@H](C#CI)OCc2ccccc2)OC(C)(C)O1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C31H47IO4Si/c1-25(36-37(7,8)30(2,3)4)17-13-10-9-11-16-20-27-23-29(35-31(5,6)34-27)28(21-22-32)33-24-26-18-14-12-15-19-26/h9,11-12,14-16,18-20,25,27-29H,10,13,17,23-24H2,1-8H3/b11-9+,20-16+/t25-,27+,28+,29-/m1/s1 |
| InChIKey | HATIRYCLPZEGLE-OEUOFJANSA-N |
| XLogP | 8.57 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.70 |
| LogP ≤ 5 | 8.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|