C32H48O8Si — CID 135021155
(2S)-2-[(4S,5R,6R)-6-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethoxyethyl]-2,2-dimethyl-5-phenylmethoxy-1,3-dioxan-4-yl]-2-phenylmethoxyacetaldehyde (PubChem CID 135021155) has the molecular formula C32H48O8Si and a molecular weight of 588.81 g/mol. Its IUPAC name is (2S)-2-[(4S,5R,6R)-6-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethoxyethyl]-2,2-dimethyl-5-phenylmethoxy-1,3-dioxan-4-yl]-2-phenylmethoxyacetaldehyde.
| Compound Name | (2S)-2-[(4S,5R,6R)-6-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethoxyethyl]-2,2-dimethyl-5-phenylmethoxy-1,3-dioxan-4-yl]-2-phenylmethoxyacetaldehyde |
|---|---|
| PubChem CID | 135021155 |
| Molecular Formula | C32H48O8Si |
| Molecular Weight | 588.81 g/mol |
| Exact Mass | 588.31 |
| IUPAC Name | (2S)-2-[(4S,5R,6R)-6-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-2,2-dimethoxyethyl]-2,2-dimethyl-5-phenylmethoxy-1,3-dioxan-4-yl]-2-phenylmethoxyacetaldehyde |
| SMILES | COC(OC)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1OC(C)(C)O[C@H]([C@@H](C=O)OCc2ccccc2)[C@H]1OCc1ccccc1 |
| InChI | InChI=1S/C32H48O8Si/c1-31(2,3)41(8,9)40-29(30(34-6)35-7)28-27(37-22-24-18-14-11-15-19-24)26(38-32(4,5)39-28)25(20-33)36-21-23-16-12-10-13-17-23/h10-20,25-30H,21-22H2,1-9H3/t25-,26-,27-,28-,29-/m1/s1 |
| InChIKey | LOKGBCUWESWERT-HWVUQVAQSA-N |
| XLogP | 5.89 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.81 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|