C30H41NO8Si — CID 11801201
benzyl N-[(1R,2S)-1-[tert-butyl(dimethyl)silyl]oxy-1-[(4R,5S)-5-(4-methoxybenzoyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-oxopropan-2-yl]carbamate (PubChem CID 11801201) has the molecular formula C30H41NO8Si and a molecular weight of 571.74 g/mol. Its IUPAC name is benzyl N-[(1R,2S)-1-[tert-butyl(dimethyl)silyl]oxy-1-[(4R,5S)-5-(4-methoxybenzoyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-oxopropan-2-yl]carbamate.
| Compound Name | benzyl N-[(1R,2S)-1-[tert-butyl(dimethyl)silyl]oxy-1-[(4R,5S)-5-(4-methoxybenzoyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 11801201 |
| Molecular Formula | C30H41NO8Si |
| Molecular Weight | 571.74 g/mol |
| Exact Mass | 571.26 |
| IUPAC Name | benzyl N-[(1R,2S)-1-[tert-butyl(dimethyl)silyl]oxy-1-[(4R,5S)-5-(4-methoxybenzoyl)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-oxopropan-2-yl]carbamate |
| SMILES | COc1ccc(C(=O)[C@H]2OC(C)(C)O[C@H]2[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C=O)NC(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C30H41NO8Si/c1-29(2,3)40(7,8)39-25(23(18-32)31-28(34)36-19-20-12-10-9-11-13-20)27-26(37-30(4,5)38-27)24(33)21-14-16-22(35-6)17-15-21/h9-18,23,25-27H,19H2,1-8H3,(H,31,34)/t23-,25-,26-,27+/m1/s1 |
| InChIKey | ZLJJQLNKNHJSHO-WSEBHVOGSA-N |
| XLogP | 5.28 |
| TPSA | 109.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.74 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|