C28H37NO5 — CID 11027029
(2S)-2-phenylmethoxy-1-piperidin-1-yl-2-[(4S,5R,6S)-2,2,6-trimethyl-5-phenylmethoxy-1,3-dioxan-4-yl]ethanone (PubChem CID 11027029) has the molecular formula C28H37NO5 and a molecular weight of 467.61 g/mol. Its IUPAC name is (2S)-2-phenylmethoxy-1-piperidin-1-yl-2-[(4S,5R,6S)-2,2,6-trimethyl-5-phenylmethoxy-1,3-dioxan-4-yl]ethanone.
| Compound Name | (2S)-2-phenylmethoxy-1-piperidin-1-yl-2-[(4S,5R,6S)-2,2,6-trimethyl-5-phenylmethoxy-1,3-dioxan-4-yl]ethanone |
|---|---|
| PubChem CID | 11027029 |
| Molecular Formula | C28H37NO5 |
| Molecular Weight | 467.61 g/mol |
| Exact Mass | 467.27 |
| IUPAC Name | (2S)-2-phenylmethoxy-1-piperidin-1-yl-2-[(4S,5R,6S)-2,2,6-trimethyl-5-phenylmethoxy-1,3-dioxan-4-yl]ethanone |
| SMILES | C[C@@H]1OC(C)(C)O[C@H]([C@H](OCc2ccccc2)C(=O)N2CCCCC2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C28H37NO5/c1-21-24(31-19-22-13-7-4-8-14-22)25(34-28(2,3)33-21)26(27(30)29-17-11-6-12-18-29)32-20-23-15-9-5-10-16-23/h4-5,7-10,13-16,21,24-26H,6,11-12,17-20H2,1-3H3/t21-,24+,25-,26-/m0/s1 |
| InChIKey | LRGCGAPITVJIBB-QUKDMSEQSA-N |
| XLogP | 4.71 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.61 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |