C23H44O5S — CID 58753419
(1S)-1-[(3aR,5R,6S,6aR)-6-heptoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-heptylsulfanylethanol (PubChem CID 58753419) has the molecular formula C23H44O5S and a molecular weight of 432.67 g/mol. Its IUPAC name is (1S)-1-[(3aR,5R,6S,6aR)-6-heptoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-heptylsulfanylethanol.
| Compound Name | (1S)-1-[(3aR,5R,6S,6aR)-6-heptoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-heptylsulfanylethanol |
|---|---|
| PubChem CID | 58753419 |
| Molecular Formula | C23H44O5S |
| Molecular Weight | 432.67 g/mol |
| Exact Mass | 432.29 |
| IUPAC Name | (1S)-1-[(3aR,5R,6S,6aR)-6-heptoxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-heptylsulfanylethanol |
| SMILES | CCCCCCCO[C@@H]1[C@H]2OC(C)(C)O[C@H]2O[C@@H]1[C@H](O)CSCCCCCCC |
| InChI | InChI=1S/C23H44O5S/c1-5-7-9-11-13-15-25-20-19(26-22-21(20)27-23(3,4)28-22)18(24)17-29-16-14-12-10-8-6-2/h18-22,24H,5-17H2,1-4H3/t18-,19-,20+,21-,22-/m1/s1 |
| InChIKey | XSQDUCMVTLGHML-QMCAAQAGSA-N |
| XLogP | 5.28 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.67 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|