C19H27BrO5 — CID 70480036
(1S)-1-[(3aR,5R,6S,6aR)-6-[(2-bromophenyl)methoxy]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]pentan-1-ol (PubChem CID 70480036) has the molecular formula C19H27BrO5 and a molecular weight of 415.32 g/mol. Its IUPAC name is (1S)-1-[(3aR,5R,6S,6aR)-6-[(2-bromophenyl)methoxy]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]pentan-1-ol.
| Compound Name | (1S)-1-[(3aR,5R,6S,6aR)-6-[(2-bromophenyl)methoxy]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]pentan-1-ol |
|---|---|
| PubChem CID | 70480036 |
| Molecular Formula | C19H27BrO5 |
| Molecular Weight | 415.32 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | (1S)-1-[(3aR,5R,6S,6aR)-6-[(2-bromophenyl)methoxy]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]pentan-1-ol |
| SMILES | CCCC[C@H](O)[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]1OCc1ccccc1Br |
| InChI | InChI=1S/C19H27BrO5/c1-4-5-10-14(21)15-16(17-18(23-15)25-19(2,3)24-17)22-11-12-8-6-7-9-13(12)20/h6-9,14-18,21H,4-5,10-11H2,1-3H3/t14-,15+,16-,17+,18+/m0/s1 |
| InChIKey | RYGIOLDAHRKVEA-IGKNDFSCSA-N |
| XLogP | 3.76 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.32 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |