C15H21FO5 — CID 18597871
(3aR,5R,6S,6aR)-6-[(2-fluorofuran-3-yl)methoxy]-2,2-dimethyl-5-propyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole (PubChem CID 18597871) has the molecular formula C15H21FO5 and a molecular weight of 300.33 g/mol. Its IUPAC name is (3aR,5R,6S,6aR)-6-[(2-fluorofuran-3-yl)methoxy]-2,2-dimethyl-5-propyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole.
| Compound Name | (3aR,5R,6S,6aR)-6-[(2-fluorofuran-3-yl)methoxy]-2,2-dimethyl-5-propyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
|---|---|
| PubChem CID | 18597871 |
| Molecular Formula | C15H21FO5 |
| Molecular Weight | 300.33 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | (3aR,5R,6S,6aR)-6-[(2-fluorofuran-3-yl)methoxy]-2,2-dimethyl-5-propyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
| SMILES | CCC[C@H]1O[C@@H]2OC(C)(C)O[C@@H]2[C@H]1OCc1ccoc1F |
| InChI | InChI=1S/C15H21FO5/c1-4-5-10-11(18-8-9-6-7-17-13(9)16)12-14(19-10)21-15(2,3)20-12/h6-7,10-12,14H,4-5,8H2,1-3H3/t10-,11+,12-,14-/m1/s1 |
| InChIKey | HXXHCQUXXJYBDI-GFQSEFKGSA-N |
| XLogP | 2.98 |
| TPSA | 50.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.33 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |