C14H21N3O4 — CID 11737990
4-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]pyrimidin-2-amine (PubChem CID 11737990) has the molecular formula C14H21N3O4 and a molecular weight of 295.34 g/mol. Its IUPAC name is 4-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]pyrimidin-2-amine.
| Compound Name | 4-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 11737990 |
| Molecular Formula | C14H21N3O4 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | 4-[(4R,5S)-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxolan-4-yl]pyrimidin-2-amine |
| SMILES | CC1(C)O[C@H]([C@H]2COC(C)(C)O2)[C@@H](c2ccnc(N)n2)O1 |
| InChI | InChI=1S/C14H21N3O4/c1-13(2)18-7-9(19-13)11-10(20-14(3,4)21-11)8-5-6-16-12(15)17-8/h5-6,9-11H,7H2,1-4H3,(H2,15,16,17)/t9-,10-,11-/m1/s1 |
| InChIKey | MREFKBNIOBLVQE-GMTAPVOTSA-N |
| XLogP | 1.40 |
| TPSA | 88.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |