C28H30O8 — CID 102064706
[(4aR,6S,7R,8S,8aR)-7-(4-ethenylbenzoyl)oxy-6-methoxy-2,2-dimethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] 4-ethenylbenzoate (PubChem CID 102064706) has the molecular formula C28H30O8 and a molecular weight of 494.54 g/mol. Its IUPAC name is [(4aR,6S,7R,8S,8aR)-7-(4-ethenylbenzoyl)oxy-6-methoxy-2,2-dimethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] 4-ethenylbenzoate.
| Compound Name | [(4aR,6S,7R,8S,8aR)-7-(4-ethenylbenzoyl)oxy-6-methoxy-2,2-dimethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] 4-ethenylbenzoate |
|---|---|
| PubChem CID | 102064706 |
| Molecular Formula | C28H30O8 |
| Molecular Weight | 494.54 g/mol |
| Exact Mass | 494.19 |
| IUPAC Name | [(4aR,6S,7R,8S,8aR)-7-(4-ethenylbenzoyl)oxy-6-methoxy-2,2-dimethyl-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3]dioxin-8-yl] 4-ethenylbenzoate |
| SMILES | C=Cc1ccc(C(=O)O[C@@H]2[C@@H](OC(=O)c3ccc(C=C)cc3)[C@@H](OC)O[C@@H]3COC(C)(C)O[C@@H]23)cc1 |
| InChI | InChI=1S/C28H30O8/c1-6-17-8-12-19(13-9-17)25(29)34-23-22-21(16-32-28(3,4)36-22)33-27(31-5)24(23)35-26(30)20-14-10-18(7-2)11-15-20/h6-15,21-24,27H,1-2,16H2,3-5H3/t21-,22-,23+,24-,27+/m1/s1 |
| InChIKey | MWYVLTVMWOEQSN-CXBVJKJKSA-N |
| XLogP | 4.25 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.54 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |