C29H56N2O4 — CID 123374150
1-O-[3-methyl-3-(2-methylbutan-2-ylamino)butyl] 10-O-(2,2,6,6-tetramethylpiperidin-4-yl) decanedioate (PubChem CID 123374150) has the molecular formula C29H56N2O4 and a molecular weight of 496.78 g/mol. Its IUPAC name is 1-O-[3-methyl-3-(2-methylbutan-2-ylamino)butyl] 10-O-(2,2,6,6-tetramethylpiperidin-4-yl) decanedioate.
| Compound Name | 1-O-[3-methyl-3-(2-methylbutan-2-ylamino)butyl] 10-O-(2,2,6,6-tetramethylpiperidin-4-yl) decanedioate |
|---|---|
| PubChem CID | 123374150 |
| Molecular Formula | C29H56N2O4 |
| Molecular Weight | 496.78 g/mol |
| Exact Mass | 496.42 |
| IUPAC Name | 1-O-[3-methyl-3-(2-methylbutan-2-ylamino)butyl] 10-O-(2,2,6,6-tetramethylpiperidin-4-yl) decanedioate |
| SMILES | CCC(C)(C)NC(C)(C)CCOC(=O)CCCCCCCCC(=O)OC1CC(C)(C)NC(C)(C)C1 |
| InChI | InChI=1S/C29H56N2O4/c1-10-26(2,3)30-27(4,5)19-20-34-24(32)17-15-13-11-12-14-16-18-25(33)35-23-21-28(6,7)31-29(8,9)22-23/h23,30-31H,10-22H2,1-9H3 |
| InChIKey | IAMFUNNPNQWUQU-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.78 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|