C39H50N2O4 — CID 129197853
bis(2,2,6,6-tetramethylpiperidin-4-yl) 4-(4-cyclohepta-2,4,6-trien-1-ylphenyl)benzene-1,2-dicarboxylate (PubChem CID 129197853) has the molecular formula C39H50N2O4 and a molecular weight of 610.84 g/mol. Its IUPAC name is bis(2,2,6,6-tetramethylpiperidin-4-yl) 4-(4-cyclohepta-2,4,6-trien-1-ylphenyl)benzene-1,2-dicarboxylate.
| Compound Name | bis(2,2,6,6-tetramethylpiperidin-4-yl) 4-(4-cyclohepta-2,4,6-trien-1-ylphenyl)benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 129197853 |
| Molecular Formula | C39H50N2O4 |
| Molecular Weight | 610.84 g/mol |
| Exact Mass | 610.38 |
| IUPAC Name | bis(2,2,6,6-tetramethylpiperidin-4-yl) 4-(4-cyclohepta-2,4,6-trien-1-ylphenyl)benzene-1,2-dicarboxylate |
| SMILES | CC1(C)CC(OC(=O)c2ccc(-c3ccc(C4C=CC=CC=C4)cc3)cc2C(=O)OC2CC(C)(C)NC(C)(C)C2)CC(C)(C)N1 |
| InChI | InChI=1S/C39H50N2O4/c1-36(2)22-30(23-37(3,4)40-36)44-34(42)32-20-19-29(28-17-15-27(16-18-28)26-13-11-9-10-12-14-26)21-33(32)35(43)45-31-24-38(5,6)41-39(7,8)25-31/h9-21,26,30-31,40-41H,22-25H2,1-8H3 |
| InChIKey | UGLCUYSZGFZKQW-UHFFFAOYSA-N |
| XLogP | 8.05 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.84 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |