C23H27F2NO2 — CID 129197862
(2,2,6,6-tetramethylpiperidin-4-yl) 4-cyclohepta-2,4,6-trien-1-yl-2,5-difluorobenzoate (PubChem CID 129197862) has the molecular formula C23H27F2NO2 and a molecular weight of 387.47 g/mol. Its IUPAC name is (2,2,6,6-tetramethylpiperidin-4-yl) 4-cyclohepta-2,4,6-trien-1-yl-2,5-difluorobenzoate.
| Compound Name | (2,2,6,6-tetramethylpiperidin-4-yl) 4-cyclohepta-2,4,6-trien-1-yl-2,5-difluorobenzoate |
|---|---|
| PubChem CID | 129197862 |
| Molecular Formula | C23H27F2NO2 |
| Molecular Weight | 387.47 g/mol |
| Exact Mass | 387.20 |
| IUPAC Name | (2,2,6,6-tetramethylpiperidin-4-yl) 4-cyclohepta-2,4,6-trien-1-yl-2,5-difluorobenzoate |
| SMILES | CC1(C)CC(OC(=O)c2cc(F)c(C3C=CC=CC=C3)cc2F)CC(C)(C)N1 |
| InChI | InChI=1S/C23H27F2NO2/c1-22(2)13-16(14-23(3,4)26-22)28-21(27)18-12-19(24)17(11-20(18)25)15-9-7-5-6-8-10-15/h5-12,15-16,26H,13-14H2,1-4H3 |
| InChIKey | NPHZJEGIOBCRQK-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.47 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |