C54H84N4O8 — CID 122418717
tetrakis(2,2,7,7-tetramethylazepan-4-yl) naphthalene-2,3,6,7-tetracarboxylate (PubChem CID 122418717) has the molecular formula C54H84N4O8 and a molecular weight of 917.29 g/mol. Its IUPAC name is tetrakis(2,2,7,7-tetramethylazepan-4-yl) naphthalene-2,3,6,7-tetracarboxylate.
| Compound Name | tetrakis(2,2,7,7-tetramethylazepan-4-yl) naphthalene-2,3,6,7-tetracarboxylate |
|---|---|
| PubChem CID | 122418717 |
| Molecular Formula | C54H84N4O8 |
| Molecular Weight | 917.29 g/mol |
| Exact Mass | 916.63 |
| IUPAC Name | tetrakis(2,2,7,7-tetramethylazepan-4-yl) naphthalene-2,3,6,7-tetracarboxylate |
| SMILES | CC1(C)CCC(OC(=O)c2cc3cc(C(=O)OC4CCC(C)(C)NC(C)(C)C4)c(C(=O)OC4CCC(C)(C)NC(C)(C)C4)cc3cc2C(=O)OC2CCC(C)(C)NC(C)(C)C2)CC(C)(C)N1 |
| InChI | InChI=1S/C54H84N4O8/c1-47(2)21-17-35(29-51(9,10)55-47)63-43(59)39-25-33-27-41(45(61)65-37-19-23-49(5,6)57-53(13,14)31-37)42(46(62)66-38-20-24-50(7,8)58-54(15,16)32-38)28-34(33)26-40(39)44(60)64-36-18-22-48(3,4)56-52(11,12)30-36/h25-28,35-38,55-58H,17-24,29-32H2,1-16H3 |
| InChIKey | FJCOTMVOXOUUCK-UHFFFAOYSA-N |
| XLogP | 10.26 |
| TPSA | 153.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 917.29 |
| LogP ≤ 5 | 10.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|