C15H22NO2+ — CID 6945885
[(4S,6S)-2,2,6-trimethylpiperidin-1-ium-4-yl] benzoate (PubChem CID 6945885) has the molecular formula C15H22NO2+ and a molecular weight of 248.35 g/mol. Its IUPAC name is [(4S,6S)-2,2,6-trimethylpiperidin-1-ium-4-yl] benzoate.
| Compound Name | [(4S,6S)-2,2,6-trimethylpiperidin-1-ium-4-yl] benzoate |
|---|---|
| PubChem CID | 6945885 |
| Molecular Formula | C15H22NO2+ |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | [(4S,6S)-2,2,6-trimethylpiperidin-1-ium-4-yl] benzoate |
| SMILES | C[C@H]1C[C@H](OC(=O)c2ccccc2)CC(C)(C)[NH2+]1 |
| InChI | InChI=1S/C15H21NO2/c1-11-9-13(10-15(2,3)16-11)18-14(17)12-7-5-4-6-8-12/h4-8,11,13,16H,9-10H2,1-3H3/p+1/t11-,13-/m0/s1 |
| InChIKey | ZYHGIAPHLSTGMX-AAEUAGOBSA-O |
| XLogP | 1.74 |
| TPSA | 42.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |