About [(1S,5R)-5-(2-hydroxypropan-2-yl)-2-methylcyclohex-2-en-1-yl] benzoate
[(1S,5R)-5-(2-hydroxypropan-2-yl)-2-methylcyclohex-2-en-1-yl] benzoate (PubChem CID 137392181) has the molecular formula C17H22O3
and a molecular weight of 274.36 g/mol. Its IUPAC name is [(1S,5R)-5-(2-hydroxypropan-2-yl)-2-methylcyclohex-2-en-1-yl] benzoate.
Molecular Properties
| Compound Name | [(1S,5R)-5-(2-hydroxypropan-2-yl)-2-methylcyclohex-2-en-1-yl] benzoate |
| PubChem CID | 137392181 |
| Molecular Formula | C17H22O3 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.16 |
| IUPAC Name | [(1S,5R)-5-(2-hydroxypropan-2-yl)-2-methylcyclohex-2-en-1-yl] benzoate |
| SMILES | CC1=CC[C@@H](C(C)(C)O)C[C@@H]1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C17H22O3/c1-12-9-10-14(17(2,3)19)11-15(12)20-16(18)13-7-5-4-6-8-13/h4-9,14-15,19H,10-11H2,1-3H3/t14-,15+/m1/s1 |
| InChIKey | IRUIETZSNDMDDK-CABCVRRESA-N |
| XLogP | 3.34 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(1S,5R)-5-(2-hydroxypropan-2-yl)-2-methylcyclohex-2-en-1-yl] benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,5R)-5-(2-hydroxypropan-2-yl)-2-methylcyclohex-2-en-1-yl] benzoate?
The IUPAC name of [(1S,5R)-5-(2-hydroxypropan-2-yl)-2-methylcyclohex-2-en-1-yl] benzoate (CID 137392181) is [(1S,5R)-5-(2-hydroxypropan-2-yl)-2-methylcyclohex-2-en-1-yl] benzoate.
What is the SMILES notation for [(1S,5R)-5-(2-hydroxypropan-2-yl)-2-methylcyclohex-2-en-1-yl] benzoate?
The canonical SMILES for [(1S,5R)-5-(2-hydroxypropan-2-yl)-2-methylcyclohex-2-en-1-yl] benzoate is CC1=CC[C@@H](C(C)(C)O)C[C@@H]1OC(=O)c1ccccc1.
What is the InChIKey of [(1S,5R)-5-(2-hydroxypropan-2-yl)-2-methylcyclohex-2-en-1-yl] benzoate?
The InChIKey is IRUIETZSNDMDDK-CABCVRRESA-N. The full InChI is InChI=1S/C17H22O3/c1-12-9-10-14(17(2,3)19)11-15(12)20-16(18)13-7-5-4-6-8-13/h4-9,14-15,19H,10-11H2,1-3H3/t14-,15+/m1/s1.
What are the key properties of [(1S,5R)-5-(2-hydroxypropan-2-yl)-2-methylcyclohex-2-en-1-yl] benzoate?
[(1S,5R)-5-(2-hydroxypropan-2-yl)-2-methylcyclohex-2-en-1-yl] benzoate has a molecular weight of 274.36 g/mol, XLogP of 3.34, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,5R)-5-(2-hydroxypropan-2-yl)-2-methylcyclohex-2-en-1-yl] benzoate is sourced from PubChem (CID 137392181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).