About [5-(2-hydroxypropan-2-yl)-2-methylcyclohex-2-en-1-yl] (2-methoxyphenyl) carbonate
[5-(2-hydroxypropan-2-yl)-2-methylcyclohex-2-en-1-yl] (2-methoxyphenyl) carbonate (PubChem CID 70494656) has the molecular formula C18H24O5
and a molecular weight of 320.38 g/mol. Its IUPAC name is [5-(2-hydroxypropan-2-yl)-2-methylcyclohex-2-en-1-yl] (2-methoxyphenyl) carbonate.
Molecular Properties
| Compound Name | [5-(2-hydroxypropan-2-yl)-2-methylcyclohex-2-en-1-yl] (2-methoxyphenyl) carbonate |
| PubChem CID | 70494656 |
| Molecular Formula | C18H24O5 |
| Molecular Weight | 320.38 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | [5-(2-hydroxypropan-2-yl)-2-methylcyclohex-2-en-1-yl] (2-methoxyphenyl) carbonate |
| SMILES | COc1ccccc1OC(=O)OC1CC(C(C)(C)O)CC=C1C |
| InChI | InChI=1S/C18H24O5/c1-12-9-10-13(18(2,3)20)11-16(12)23-17(19)22-15-8-6-5-7-14(15)21-4/h5-9,13,16,20H,10-11H2,1-4H3 |
| InChIKey | MUGDRFUOTBOKJN-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.38 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze [5-(2-hydroxypropan-2-yl)-2-methylcyclohex-2-en-1-yl] (2-methoxyphenyl) carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-(2-hydroxypropan-2-yl)-2-methylcyclohex-2-en-1-yl] (2-methoxyphenyl) carbonate?
The IUPAC name of [5-(2-hydroxypropan-2-yl)-2-methylcyclohex-2-en-1-yl] (2-methoxyphenyl) carbonate (CID 70494656) is [5-(2-hydroxypropan-2-yl)-2-methylcyclohex-2-en-1-yl] (2-methoxyphenyl) carbonate.
What is the SMILES notation for [5-(2-hydroxypropan-2-yl)-2-methylcyclohex-2-en-1-yl] (2-methoxyphenyl) carbonate?
The canonical SMILES for [5-(2-hydroxypropan-2-yl)-2-methylcyclohex-2-en-1-yl] (2-methoxyphenyl) carbonate is COc1ccccc1OC(=O)OC1CC(C(C)(C)O)CC=C1C.
What is the InChIKey of [5-(2-hydroxypropan-2-yl)-2-methylcyclohex-2-en-1-yl] (2-methoxyphenyl) carbonate?
The InChIKey is MUGDRFUOTBOKJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24O5/c1-12-9-10-13(18(2,3)20)11-16(12)23-17(19)22-15-8-6-5-7-14(15)21-4/h5-9,13,16,20H,10-11H2,1-4H3.
What are the key properties of [5-(2-hydroxypropan-2-yl)-2-methylcyclohex-2-en-1-yl] (2-methoxyphenyl) carbonate?
[5-(2-hydroxypropan-2-yl)-2-methylcyclohex-2-en-1-yl] (2-methoxyphenyl) carbonate has a molecular weight of 320.38 g/mol, XLogP of 3.71, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5-(2-hydroxypropan-2-yl)-2-methylcyclohex-2-en-1-yl] (2-methoxyphenyl) carbonate is sourced from PubChem (CID 70494656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).