C22H25F3O4 — CID 59482820
[2-methyl-5-[2-[2-(trifluoromethyl)prop-2-enoyloxy]propan-2-yl]cyclohex-2-en-1-yl] 4-methylbenzoate (PubChem CID 59482820) has the molecular formula C22H25F3O4 and a molecular weight of 410.43 g/mol. Its IUPAC name is [2-methyl-5-[2-[2-(trifluoromethyl)prop-2-enoyloxy]propan-2-yl]cyclohex-2-en-1-yl] 4-methylbenzoate.
| Compound Name | [2-methyl-5-[2-[2-(trifluoromethyl)prop-2-enoyloxy]propan-2-yl]cyclohex-2-en-1-yl] 4-methylbenzoate |
|---|---|
| PubChem CID | 59482820 |
| Molecular Formula | C22H25F3O4 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | [2-methyl-5-[2-[2-(trifluoromethyl)prop-2-enoyloxy]propan-2-yl]cyclohex-2-en-1-yl] 4-methylbenzoate |
| SMILES | C=C(C(=O)OC(C)(C)C1CC=C(C)C(OC(=O)c2ccc(C)cc2)C1)C(F)(F)F |
| InChI | InChI=1S/C22H25F3O4/c1-13-6-9-16(10-7-13)20(27)28-18-12-17(11-8-14(18)2)21(4,5)29-19(26)15(3)22(23,24)25/h6-10,17-18H,3,11-12H2,1-2,4-5H3 |
| InChIKey | MMMKOKCOQVXNPG-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|