C23H30O2 — CID 141431296
[(3E,7E)-3,7-dimethyl-10-propan-2-ylidenecyclodeca-3,7-dien-1-yl] 4-methylbenzoate (PubChem CID 141431296) has the molecular formula C23H30O2 and a molecular weight of 338.49 g/mol. Its IUPAC name is [(3E,7E)-3,7-dimethyl-10-propan-2-ylidenecyclodeca-3,7-dien-1-yl] 4-methylbenzoate.
| Compound Name | [(3E,7E)-3,7-dimethyl-10-propan-2-ylidenecyclodeca-3,7-dien-1-yl] 4-methylbenzoate |
|---|---|
| PubChem CID | 141431296 |
| Molecular Formula | C23H30O2 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | [(3E,7E)-3,7-dimethyl-10-propan-2-ylidenecyclodeca-3,7-dien-1-yl] 4-methylbenzoate |
| SMILES | CC(C)=C1C/C=C(\C)CC/C=C(\C)CC1OC(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C23H30O2/c1-16(2)21-14-11-17(3)7-6-8-19(5)15-22(21)25-23(24)20-12-9-18(4)10-13-20/h8-13,22H,6-7,14-15H2,1-5H3/b17-11+,19-8+ |
| InChIKey | WPGBZPXHPHENGG-FNVBVLSVSA-N |
| XLogP | 6.32 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|