C20H20O6 — CID 144724305
[2-(4-methylbenzoyl)oxy-1,3-dioxan-5-yl] 4-methylbenzoate (PubChem CID 144724305) has the molecular formula C20H20O6 and a molecular weight of 356.37 g/mol. Its IUPAC name is [2-(4-methylbenzoyl)oxy-1,3-dioxan-5-yl] 4-methylbenzoate.
| Compound Name | [2-(4-methylbenzoyl)oxy-1,3-dioxan-5-yl] 4-methylbenzoate |
|---|---|
| PubChem CID | 144724305 |
| Molecular Formula | C20H20O6 |
| Molecular Weight | 356.37 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | [2-(4-methylbenzoyl)oxy-1,3-dioxan-5-yl] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OC2COC(OC(=O)c3ccc(C)cc3)OC2)cc1 |
| InChI | InChI=1S/C20H20O6/c1-13-3-7-15(8-4-13)18(21)25-17-11-23-20(24-12-17)26-19(22)16-9-5-14(2)6-10-16/h3-10,17,20H,11-12H2,1-2H3 |
| InChIKey | HPUXTYFTSJLJGJ-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.37 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |