About [(3S)-1-methylpiperidin-1-ium-3-yl] 4-methylbenzoate
[(3S)-1-methylpiperidin-1-ium-3-yl] 4-methylbenzoate (PubChem CID 7279508) has the molecular formula C14H20NO2+
and a molecular weight of 234.32 g/mol. Its IUPAC name is [(3S)-1-methylpiperidin-1-ium-3-yl] 4-methylbenzoate.
Molecular Properties
| Compound Name | [(3S)-1-methylpiperidin-1-ium-3-yl] 4-methylbenzoate |
| PubChem CID | 7279508 |
| Molecular Formula | C14H20NO2+ |
| Molecular Weight | 234.32 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | [(3S)-1-methylpiperidin-1-ium-3-yl] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)O[C@H]2CCC[NH+](C)C2)cc1 |
| InChI | InChI=1S/C14H19NO2/c1-11-5-7-12(8-6-11)14(16)17-13-4-3-9-15(2)10-13/h5-8,13H,3-4,9-10H2,1-2H3/p+1/t13-/m0/s1 |
| InChIKey | ABYXUESOTRGACZ-ZDUSSCGKSA-O |
| XLogP | 0.83 |
| TPSA | 30.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.32 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(3S)-1-methylpiperidin-1-ium-3-yl] 4-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3S)-1-methylpiperidin-1-ium-3-yl] 4-methylbenzoate?
The IUPAC name of [(3S)-1-methylpiperidin-1-ium-3-yl] 4-methylbenzoate (CID 7279508) is [(3S)-1-methylpiperidin-1-ium-3-yl] 4-methylbenzoate.
What is the SMILES notation for [(3S)-1-methylpiperidin-1-ium-3-yl] 4-methylbenzoate?
The canonical SMILES for [(3S)-1-methylpiperidin-1-ium-3-yl] 4-methylbenzoate is Cc1ccc(C(=O)O[C@H]2CCC[NH+](C)C2)cc1.
What is the InChIKey of [(3S)-1-methylpiperidin-1-ium-3-yl] 4-methylbenzoate?
The InChIKey is ABYXUESOTRGACZ-ZDUSSCGKSA-O. The full InChI is InChI=1S/C14H19NO2/c1-11-5-7-12(8-6-11)14(16)17-13-4-3-9-15(2)10-13/h5-8,13H,3-4,9-10H2,1-2H3/p+1/t13-/m0/s1.
What are the key properties of [(3S)-1-methylpiperidin-1-ium-3-yl] 4-methylbenzoate?
[(3S)-1-methylpiperidin-1-ium-3-yl] 4-methylbenzoate has a molecular weight of 234.32 g/mol, XLogP of 0.83, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(3S)-1-methylpiperidin-1-ium-3-yl] 4-methylbenzoate is sourced from PubChem (CID 7279508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).