C23H30O4 — CID 59482793
[2-methyl-5-[2-(2-methylprop-2-enoyloxy)propan-2-yl]cyclohex-2-en-1-yl] 2,4-dimethylbenzoate (PubChem CID 59482793) has the molecular formula C23H30O4 and a molecular weight of 370.49 g/mol. Its IUPAC name is [2-methyl-5-[2-(2-methylprop-2-enoyloxy)propan-2-yl]cyclohex-2-en-1-yl] 2,4-dimethylbenzoate.
| Compound Name | [2-methyl-5-[2-(2-methylprop-2-enoyloxy)propan-2-yl]cyclohex-2-en-1-yl] 2,4-dimethylbenzoate |
|---|---|
| PubChem CID | 59482793 |
| Molecular Formula | C23H30O4 |
| Molecular Weight | 370.49 g/mol |
| Exact Mass | 370.21 |
| IUPAC Name | [2-methyl-5-[2-(2-methylprop-2-enoyloxy)propan-2-yl]cyclohex-2-en-1-yl] 2,4-dimethylbenzoate |
| SMILES | C=C(C)C(=O)OC(C)(C)C1CC=C(C)C(OC(=O)c2ccc(C)cc2C)C1 |
| InChI | InChI=1S/C23H30O4/c1-14(2)21(24)27-23(6,7)18-10-9-16(4)20(13-18)26-22(25)19-11-8-15(3)12-17(19)5/h8-9,11-12,18,20H,1,10,13H2,2-7H3 |
| InChIKey | IDCYRQFTJWPYCS-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.49 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|