C18H20O3 — CID 10684473
(6-hydroxy-8a-methyl-2,3,4,6-tetrahydro-1H-naphthalen-1-yl) benzoate (PubChem CID 10684473) has the molecular formula C18H20O3 and a molecular weight of 284.36 g/mol. Its IUPAC name is (6-hydroxy-8a-methyl-2,3,4,6-tetrahydro-1H-naphthalen-1-yl) benzoate.
| Compound Name | (6-hydroxy-8a-methyl-2,3,4,6-tetrahydro-1H-naphthalen-1-yl) benzoate |
|---|---|
| PubChem CID | 10684473 |
| Molecular Formula | C18H20O3 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | (6-hydroxy-8a-methyl-2,3,4,6-tetrahydro-1H-naphthalen-1-yl) benzoate |
| SMILES | CC12C=CC(O)C=C1CCCC2OC(=O)c1ccccc1 |
| InChI | InChI=1S/C18H20O3/c1-18-11-10-15(19)12-14(18)8-5-9-16(18)21-17(20)13-6-3-2-4-7-13/h2-4,6-7,10-12,15-16,19H,5,8-9H2,1H3 |
| InChIKey | XOLMKKYBLUULQB-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|