C29H34O4 — CID 90270948
[(8R,9S,10R,13S,14R,17R)-17-acetyl-10,13,16-trimethyl-3-oxo-2,6,7,8,9,11,12,14-octahydro-1H-cyclopenta[a]phenanthren-17-yl] benzoate (PubChem CID 90270948) has the molecular formula C29H34O4 and a molecular weight of 446.59 g/mol. Its IUPAC name is [(8R,9S,10R,13S,14R,17R)-17-acetyl-10,13,16-trimethyl-3-oxo-2,6,7,8,9,11,12,14-octahydro-1H-cyclopenta[a]phenanthren-17-yl] benzoate.
| Compound Name | [(8R,9S,10R,13S,14R,17R)-17-acetyl-10,13,16-trimethyl-3-oxo-2,6,7,8,9,11,12,14-octahydro-1H-cyclopenta[a]phenanthren-17-yl] benzoate |
|---|---|
| PubChem CID | 90270948 |
| Molecular Formula | C29H34O4 |
| Molecular Weight | 446.59 g/mol |
| Exact Mass | 446.25 |
| IUPAC Name | [(8R,9S,10R,13S,14R,17R)-17-acetyl-10,13,16-trimethyl-3-oxo-2,6,7,8,9,11,12,14-octahydro-1H-cyclopenta[a]phenanthren-17-yl] benzoate |
| SMILES | CC(=O)[C@@]1(OC(=O)c2ccccc2)C(C)=C[C@H]2[C@@H]3CCC4=CC(=O)CC[C@]4(C)[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C29H34O4/c1-18-16-25-23-11-10-21-17-22(31)12-14-27(21,3)24(23)13-15-28(25,4)29(18,19(2)30)33-26(32)20-8-6-5-7-9-20/h5-9,16-17,23-25H,10-15H2,1-4H3/t23-,24+,25+,27+,28+,29+/m1/s1 |
| InChIKey | UVRZNUCBPVFBSA-YHXSMJMOSA-N |
| XLogP | 5.87 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.59 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|