C17H20O3 — CID 102282186
[(1S,2R,6S)-1-[(E)-but-2-enyl]-7-oxabicyclo[4.1.0]heptan-2-yl] benzoate (PubChem CID 102282186) has the molecular formula C17H20O3 and a molecular weight of 272.34 g/mol. Its IUPAC name is [(1S,2R,6S)-1-[(E)-but-2-enyl]-7-oxabicyclo[4.1.0]heptan-2-yl] benzoate.
| Compound Name | [(1S,2R,6S)-1-[(E)-but-2-enyl]-7-oxabicyclo[4.1.0]heptan-2-yl] benzoate |
|---|---|
| PubChem CID | 102282186 |
| Molecular Formula | C17H20O3 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | [(1S,2R,6S)-1-[(E)-but-2-enyl]-7-oxabicyclo[4.1.0]heptan-2-yl] benzoate |
| SMILES | C/C=C/C[C@]12O[C@H]1CCC[C@H]2OC(=O)c1ccccc1 |
| InChI | InChI=1S/C17H20O3/c1-2-3-12-17-14(10-7-11-15(17)20-17)19-16(18)13-8-5-4-6-9-13/h2-6,8-9,14-15H,7,10-12H2,1H3/b3-2+/t14-,15+,17-/m1/s1 |
| InChIKey | SWQMLKCYZGQFOI-PTFJMEJDSA-N |
| XLogP | 3.50 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|