About [(5S,6S)-4-oxo-2-(trifluoromethyl)-1-oxaspiro[4.5]dec-2-en-6-yl] benzoate
[(5S,6S)-4-oxo-2-(trifluoromethyl)-1-oxaspiro[4.5]dec-2-en-6-yl] benzoate (PubChem CID 15882846) has the molecular formula C17H15F3O4
and a molecular weight of 340.30 g/mol. Its IUPAC name is [(5S,6S)-4-oxo-2-(trifluoromethyl)-1-oxaspiro[4.5]dec-2-en-6-yl] benzoate.
Molecular Properties
| Compound Name | [(5S,6S)-4-oxo-2-(trifluoromethyl)-1-oxaspiro[4.5]dec-2-en-6-yl] benzoate |
| PubChem CID | 15882846 |
| Molecular Formula | C17H15F3O4 |
| Molecular Weight | 340.30 g/mol |
| Exact Mass | 340.09 |
| IUPAC Name | [(5S,6S)-4-oxo-2-(trifluoromethyl)-1-oxaspiro[4.5]dec-2-en-6-yl] benzoate |
| SMILES | O=C(O[C@H]1CCCC[C@]12OC(C(F)(F)F)=CC2=O)c1ccccc1 |
| InChI | InChI=1S/C17H15F3O4/c18-17(19,20)14-10-12(21)16(24-14)9-5-4-8-13(16)23-15(22)11-6-2-1-3-7-11/h1-3,6-7,10,13H,4-5,8-9H2/t13-,16+/m0/s1 |
| InChIKey | KWDMENQFTWTXQO-XJKSGUPXSA-N |
| XLogP | 3.57 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.30 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [(5S,6S)-4-oxo-2-(trifluoromethyl)-1-oxaspiro[4.5]dec-2-en-6-yl] benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(5S,6S)-4-oxo-2-(trifluoromethyl)-1-oxaspiro[4.5]dec-2-en-6-yl] benzoate?
The IUPAC name of [(5S,6S)-4-oxo-2-(trifluoromethyl)-1-oxaspiro[4.5]dec-2-en-6-yl] benzoate (CID 15882846) is [(5S,6S)-4-oxo-2-(trifluoromethyl)-1-oxaspiro[4.5]dec-2-en-6-yl] benzoate.
What is the SMILES notation for [(5S,6S)-4-oxo-2-(trifluoromethyl)-1-oxaspiro[4.5]dec-2-en-6-yl] benzoate?
The canonical SMILES for [(5S,6S)-4-oxo-2-(trifluoromethyl)-1-oxaspiro[4.5]dec-2-en-6-yl] benzoate is O=C(O[C@H]1CCCC[C@]12OC(C(F)(F)F)=CC2=O)c1ccccc1.
What is the InChIKey of [(5S,6S)-4-oxo-2-(trifluoromethyl)-1-oxaspiro[4.5]dec-2-en-6-yl] benzoate?
The InChIKey is KWDMENQFTWTXQO-XJKSGUPXSA-N. The full InChI is InChI=1S/C17H15F3O4/c18-17(19,20)14-10-12(21)16(24-14)9-5-4-8-13(16)23-15(22)11-6-2-1-3-7-11/h1-3,6-7,10,13H,4-5,8-9H2/t13-,16+/m0/s1.
What are the key properties of [(5S,6S)-4-oxo-2-(trifluoromethyl)-1-oxaspiro[4.5]dec-2-en-6-yl] benzoate?
[(5S,6S)-4-oxo-2-(trifluoromethyl)-1-oxaspiro[4.5]dec-2-en-6-yl] benzoate has a molecular weight of 340.30 g/mol, XLogP of 3.57, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(5S,6S)-4-oxo-2-(trifluoromethyl)-1-oxaspiro[4.5]dec-2-en-6-yl] benzoate is sourced from PubChem (CID 15882846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).