C21H19F4NO3 — CID 132580074
[(1R,2R)-2-(4-fluorophenyl)-2-[(2,2,2-trifluoroacetyl)amino]cyclohexyl] benzoate (PubChem CID 132580074) has the molecular formula C21H19F4NO3 and a molecular weight of 409.38 g/mol. Its IUPAC name is [(1R,2R)-2-(4-fluorophenyl)-2-[(2,2,2-trifluoroacetyl)amino]cyclohexyl] benzoate.
| Compound Name | [(1R,2R)-2-(4-fluorophenyl)-2-[(2,2,2-trifluoroacetyl)amino]cyclohexyl] benzoate |
|---|---|
| PubChem CID | 132580074 |
| Molecular Formula | C21H19F4NO3 |
| Molecular Weight | 409.38 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | [(1R,2R)-2-(4-fluorophenyl)-2-[(2,2,2-trifluoroacetyl)amino]cyclohexyl] benzoate |
| SMILES | O=C(O[C@@H]1CCCC[C@@]1(NC(=O)C(F)(F)F)c1ccc(F)cc1)c1ccccc1 |
| InChI | InChI=1S/C21H19F4NO3/c22-16-11-9-15(10-12-16)20(26-19(28)21(23,24)25)13-5-4-8-17(20)29-18(27)14-6-2-1-3-7-14/h1-3,6-7,9-12,17H,4-5,8,13H2,(H,26,28)/t17-,20-/m1/s1 |
| InChIKey | CHUYGOHFXOJLMP-YLJYHZDGSA-N |
| XLogP | 4.50 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.38 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |