C17H20F3NO5 — CID 11653681
[(2S,3S,4S,6S)-6-methoxy-2,4-dimethyl-4-[(2,2,2-trifluoroacetyl)amino]oxan-3-yl] benzoate (PubChem CID 11653681) has the molecular formula C17H20F3NO5 and a molecular weight of 375.34 g/mol. Its IUPAC name is [(2S,3S,4S,6S)-6-methoxy-2,4-dimethyl-4-[(2,2,2-trifluoroacetyl)amino]oxan-3-yl] benzoate.
| Compound Name | [(2S,3S,4S,6S)-6-methoxy-2,4-dimethyl-4-[(2,2,2-trifluoroacetyl)amino]oxan-3-yl] benzoate |
|---|---|
| PubChem CID | 11653681 |
| Molecular Formula | C17H20F3NO5 |
| Molecular Weight | 375.34 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | [(2S,3S,4S,6S)-6-methoxy-2,4-dimethyl-4-[(2,2,2-trifluoroacetyl)amino]oxan-3-yl] benzoate |
| SMILES | CO[C@@H]1C[C@](C)(NC(=O)C(F)(F)F)[C@H](OC(=O)c2ccccc2)[C@H](C)O1 |
| InChI | InChI=1S/C17H20F3NO5/c1-10-13(26-14(22)11-7-5-4-6-8-11)16(2,9-12(24-3)25-10)21-15(23)17(18,19)20/h4-8,10,12-13H,9H2,1-3H3,(H,21,23)/t10-,12-,13+,16-/m0/s1 |
| InChIKey | GUCIVYCHIVJNAB-VFFTVRQLSA-N |
| XLogP | 2.43 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.34 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |