C26H22N2O6 — CID 11037840
[(2R,5S,9S)-2-(3-benzoyl-2,4-dioxopyrimidin-1-yl)-1-oxaspiro[4.4]non-3-en-9-yl] benzoate (PubChem CID 11037840) has the molecular formula C26H22N2O6 and a molecular weight of 458.47 g/mol. Its IUPAC name is [(2R,5S,9S)-2-(3-benzoyl-2,4-dioxopyrimidin-1-yl)-1-oxaspiro[4.4]non-3-en-9-yl] benzoate.
| Compound Name | [(2R,5S,9S)-2-(3-benzoyl-2,4-dioxopyrimidin-1-yl)-1-oxaspiro[4.4]non-3-en-9-yl] benzoate |
|---|---|
| PubChem CID | 11037840 |
| Molecular Formula | C26H22N2O6 |
| Molecular Weight | 458.47 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | [(2R,5S,9S)-2-(3-benzoyl-2,4-dioxopyrimidin-1-yl)-1-oxaspiro[4.4]non-3-en-9-yl] benzoate |
| SMILES | O=C(O[C@H]1CCC[C@]12C=C[C@H](n1ccc(=O)n(C(=O)c3ccccc3)c1=O)O2)c1ccccc1 |
| InChI | InChI=1S/C26H22N2O6/c29-21-14-17-27(25(32)28(21)23(30)18-8-3-1-4-9-18)22-13-16-26(34-22)15-7-12-20(26)33-24(31)19-10-5-2-6-11-19/h1-6,8-11,13-14,16-17,20,22H,7,12,15H2/t20-,22+,26-/m0/s1 |
| InChIKey | PNZOIECNCHVYNL-HXAGEGRHSA-N |
| XLogP | 2.93 |
| TPSA | 96.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.47 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|