C17H18N2O4 — CID 25267898
3-benzoyl-1-(4-hydroxycyclohexyl)pyrimidine-2,4-dione (PubChem CID 25267898) has the molecular formula C17H18N2O4 and a molecular weight of 314.34 g/mol. Its IUPAC name is 3-benzoyl-1-(4-hydroxycyclohexyl)pyrimidine-2,4-dione.
| Compound Name | 3-benzoyl-1-(4-hydroxycyclohexyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 25267898 |
| Molecular Formula | C17H18N2O4 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 3-benzoyl-1-(4-hydroxycyclohexyl)pyrimidine-2,4-dione |
| SMILES | O=C(c1ccccc1)n1c(=O)ccn(C2CCC(O)CC2)c1=O |
| InChI | InChI=1S/C17H18N2O4/c20-14-8-6-13(7-9-14)18-11-10-15(21)19(17(18)23)16(22)12-4-2-1-3-5-12/h1-5,10-11,13-14,20H,6-9H2 |
| InChIKey | NIKDCOLESHPJTN-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 81.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |