C16H12N2O4 — CID 132530733
3-benzoyl-1-(5-oxocyclopenten-1-yl)pyrimidine-2,4-dione (PubChem CID 132530733) has the molecular formula C16H12N2O4 and a molecular weight of 296.28 g/mol. Its IUPAC name is 3-benzoyl-1-(5-oxocyclopenten-1-yl)pyrimidine-2,4-dione.
| Compound Name | 3-benzoyl-1-(5-oxocyclopenten-1-yl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 132530733 |
| Molecular Formula | C16H12N2O4 |
| Molecular Weight | 296.28 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 3-benzoyl-1-(5-oxocyclopenten-1-yl)pyrimidine-2,4-dione |
| SMILES | O=C1CCC=C1n1ccc(=O)n(C(=O)c2ccccc2)c1=O |
| InChI | InChI=1S/C16H12N2O4/c19-13-8-4-7-12(13)17-10-9-14(20)18(16(17)22)15(21)11-5-2-1-3-6-11/h1-3,5-7,9-10H,4,8H2 |
| InChIKey | KRVUTJFFKQWKIE-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 78.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.28 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |