C24H19N3O7 — CID 25267894
[(1R,4S)-4-(3-benzoyl-2,4-dioxopyrimidin-1-yl)cyclohex-2-en-1-yl] 4-nitrobenzoate (PubChem CID 25267894) has the molecular formula C24H19N3O7 and a molecular weight of 461.43 g/mol. Its IUPAC name is [(1R,4S)-4-(3-benzoyl-2,4-dioxopyrimidin-1-yl)cyclohex-2-en-1-yl] 4-nitrobenzoate.
| Compound Name | [(1R,4S)-4-(3-benzoyl-2,4-dioxopyrimidin-1-yl)cyclohex-2-en-1-yl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 25267894 |
| Molecular Formula | C24H19N3O7 |
| Molecular Weight | 461.43 g/mol |
| Exact Mass | 461.12 |
| IUPAC Name | [(1R,4S)-4-(3-benzoyl-2,4-dioxopyrimidin-1-yl)cyclohex-2-en-1-yl] 4-nitrobenzoate |
| SMILES | O=C(O[C@H]1C=C[C@@H](n2ccc(=O)n(C(=O)c3ccccc3)c2=O)CC1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H19N3O7/c28-21-14-15-25(24(31)26(21)22(29)16-4-2-1-3-5-16)18-10-12-20(13-11-18)34-23(30)17-6-8-19(9-7-17)27(32)33/h1-10,12,14-15,18,20H,11,13H2/t18-,20+/m1/s1 |
| InChIKey | RAICTNOLTOHQKS-QUCCMNQESA-N |
| XLogP | 2.72 |
| TPSA | 130.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.43 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|