C16H13N3O5 — CID 100999365
3-(4-nitrobenzoyl)-1-pent-4-ynylpyrimidine-2,4-dione (PubChem CID 100999365) has the molecular formula C16H13N3O5 and a molecular weight of 327.30 g/mol. Its IUPAC name is 3-(4-nitrobenzoyl)-1-pent-4-ynylpyrimidine-2,4-dione.
| Compound Name | 3-(4-nitrobenzoyl)-1-pent-4-ynylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 100999365 |
| Molecular Formula | C16H13N3O5 |
| Molecular Weight | 327.30 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | 3-(4-nitrobenzoyl)-1-pent-4-ynylpyrimidine-2,4-dione |
| SMILES | C#CCCCn1ccc(=O)n(C(=O)c2ccc([N+](=O)[O-])cc2)c1=O |
| InChI | InChI=1S/C16H13N3O5/c1-2-3-4-10-17-11-9-14(20)18(16(17)22)15(21)12-5-7-13(8-6-12)19(23)24/h1,5-9,11H,3-4,10H2 |
| InChIKey | AUIUYBWACRGJMO-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 104.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.30 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|