C28H27N3O5 — CID 14403398
[3-benzyl-7-(4-nitrobenzoyl)-3,7-diazabicyclo[3.3.1]nonan-9-yl] benzoate (PubChem CID 14403398) has the molecular formula C28H27N3O5 and a molecular weight of 485.54 g/mol. Its IUPAC name is [3-benzyl-7-(4-nitrobenzoyl)-3,7-diazabicyclo[3.3.1]nonan-9-yl] benzoate.
| Compound Name | [3-benzyl-7-(4-nitrobenzoyl)-3,7-diazabicyclo[3.3.1]nonan-9-yl] benzoate |
|---|---|
| PubChem CID | 14403398 |
| Molecular Formula | C28H27N3O5 |
| Molecular Weight | 485.54 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | [3-benzyl-7-(4-nitrobenzoyl)-3,7-diazabicyclo[3.3.1]nonan-9-yl] benzoate |
| SMILES | O=C(OC1C2CN(Cc3ccccc3)CC1CN(C(=O)c1ccc([N+](=O)[O-])cc1)C2)c1ccccc1 |
| InChI | InChI=1S/C28H27N3O5/c32-27(21-11-13-25(14-12-21)31(34)35)30-18-23-16-29(15-20-7-3-1-4-8-20)17-24(19-30)26(23)36-28(33)22-9-5-2-6-10-22/h1-14,23-24,26H,15-19H2 |
| InChIKey | CSXPKWSFJCTAQD-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 92.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.54 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|