C17H24N2O2 — CID 14368022
(3-ethyl-7-methyl-3,7-diazabicyclo[3.3.1]nonan-9-yl) benzoate (PubChem CID 14368022) has the molecular formula C17H24N2O2 and a molecular weight of 288.39 g/mol. Its IUPAC name is (3-ethyl-7-methyl-3,7-diazabicyclo[3.3.1]nonan-9-yl) benzoate.
| Compound Name | (3-ethyl-7-methyl-3,7-diazabicyclo[3.3.1]nonan-9-yl) benzoate |
|---|---|
| PubChem CID | 14368022 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | (3-ethyl-7-methyl-3,7-diazabicyclo[3.3.1]nonan-9-yl) benzoate |
| SMILES | CCN1CC2CN(C)CC(C1)C2OC(=O)c1ccccc1 |
| InChI | InChI=1S/C17H24N2O2/c1-3-19-11-14-9-18(2)10-15(12-19)16(14)21-17(20)13-7-5-4-6-8-13/h4-8,14-16H,3,9-12H2,1-2H3 |
| InChIKey | MTSIPINBKVSFAT-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |