C25H25N3O3 — CID 96534422
5-[(3aS,6aR)-2-benzyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]-2-cyclopropylisoindole-1,3-dione (PubChem CID 96534422) has the molecular formula C25H25N3O3 and a molecular weight of 415.49 g/mol. Its IUPAC name is 5-[(3aS,6aR)-2-benzyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]-2-cyclopropylisoindole-1,3-dione.
| Compound Name | 5-[(3aS,6aR)-2-benzyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]-2-cyclopropylisoindole-1,3-dione |
|---|---|
| PubChem CID | 96534422 |
| Molecular Formula | C25H25N3O3 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | 5-[(3aS,6aR)-2-benzyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carbonyl]-2-cyclopropylisoindole-1,3-dione |
| SMILES | O=C(c1ccc2c(c1)C(=O)N(C1CC1)C2=O)N1C[C@H]2CN(Cc3ccccc3)C[C@H]2C1 |
| InChI | InChI=1S/C25H25N3O3/c29-23(17-6-9-21-22(10-17)25(31)28(24(21)30)20-7-8-20)27-14-18-12-26(13-19(18)15-27)11-16-4-2-1-3-5-16/h1-6,9-10,18-20H,7-8,11-15H2/t18-,19+ |
| InChIKey | JLOXQGMEOTWIML-KDURUIRLSA-N |
| XLogP | 2.65 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|