C22H26N2O5 — CID 122119284
1-(2-cyclohexyl-1,3-dioxoisoindole-5-carbonyl)-5-methylpiperidine-3-carboxylic acid (PubChem CID 122119284) has the molecular formula C22H26N2O5 and a molecular weight of 398.46 g/mol. Its IUPAC name is 1-(2-cyclohexyl-1,3-dioxoisoindole-5-carbonyl)-5-methylpiperidine-3-carboxylic acid.
| Compound Name | 1-(2-cyclohexyl-1,3-dioxoisoindole-5-carbonyl)-5-methylpiperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122119284 |
| Molecular Formula | C22H26N2O5 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | 1-(2-cyclohexyl-1,3-dioxoisoindole-5-carbonyl)-5-methylpiperidine-3-carboxylic acid |
| SMILES | CC1CC(C(=O)O)CN(C(=O)c2ccc3c(c2)C(=O)N(C2CCCCC2)C3=O)C1 |
| InChI | InChI=1S/C22H26N2O5/c1-13-9-15(22(28)29)12-23(11-13)19(25)14-7-8-17-18(10-14)21(27)24(20(17)26)16-5-3-2-4-6-16/h7-8,10,13,15-16H,2-6,9,11-12H2,1H3,(H,28,29) |
| InChIKey | NSYRGJWHDZFEHI-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 94.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|