C23H25N3O3S — CID 56579447
2-cyclohexyl-5-[3-(1,3-thiazol-2-yl)piperidine-1-carbonyl]isoindole-1,3-dione (PubChem CID 56579447) has the molecular formula C23H25N3O3S and a molecular weight of 423.54 g/mol. Its IUPAC name is 2-cyclohexyl-5-[3-(1,3-thiazol-2-yl)piperidine-1-carbonyl]isoindole-1,3-dione.
| Compound Name | 2-cyclohexyl-5-[3-(1,3-thiazol-2-yl)piperidine-1-carbonyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 56579447 |
| Molecular Formula | C23H25N3O3S |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.16 |
| IUPAC Name | 2-cyclohexyl-5-[3-(1,3-thiazol-2-yl)piperidine-1-carbonyl]isoindole-1,3-dione |
| SMILES | O=C(c1ccc2c(c1)C(=O)N(C1CCCCC1)C2=O)N1CCCC(c2nccs2)C1 |
| InChI | InChI=1S/C23H25N3O3S/c27-21(25-11-4-5-16(14-25)20-24-10-12-30-20)15-8-9-18-19(13-15)23(29)26(22(18)28)17-6-2-1-3-7-17/h8-10,12-13,16-17H,1-7,11,14H2 |
| InChIKey | MBLJWHZSPOPDRK-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|