C17H15N3O5 — CID 25171691
[(1R,4R)-4-(2-carbamoylpyrrol-1-yl)cyclopent-2-en-1-yl] 4-nitrobenzoate (PubChem CID 25171691) has the molecular formula C17H15N3O5 and a molecular weight of 341.32 g/mol. Its IUPAC name is [(1R,4R)-4-(2-carbamoylpyrrol-1-yl)cyclopent-2-en-1-yl] 4-nitrobenzoate.
| Compound Name | [(1R,4R)-4-(2-carbamoylpyrrol-1-yl)cyclopent-2-en-1-yl] 4-nitrobenzoate |
|---|---|
| PubChem CID | 25171691 |
| Molecular Formula | C17H15N3O5 |
| Molecular Weight | 341.32 g/mol |
| Exact Mass | 341.10 |
| IUPAC Name | [(1R,4R)-4-(2-carbamoylpyrrol-1-yl)cyclopent-2-en-1-yl] 4-nitrobenzoate |
| SMILES | NC(=O)c1cccn1[C@H]1C=C[C@H](OC(=O)c2ccc([N+](=O)[O-])cc2)C1 |
| InChI | InChI=1S/C17H15N3O5/c18-16(21)15-2-1-9-19(15)13-7-8-14(10-13)25-17(22)11-3-5-12(6-4-11)20(23)24/h1-9,13-14H,10H2,(H2,18,21)/t13-,14-/m0/s1 |
| InChIKey | JEBARVIHOHLSDJ-KBPBESRZSA-N |
| XLogP | 2.22 |
| TPSA | 117.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.32 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|