C12H14N4O4S — CID 88693105
[(E)-[amino-(3-sulfanylpyrrolidin-1-yl)methylidene]amino] 4-nitrobenzoate (PubChem CID 88693105) has the molecular formula C12H14N4O4S and a molecular weight of 310.33 g/mol. Its IUPAC name is [(E)-[amino-(3-sulfanylpyrrolidin-1-yl)methylidene]amino] 4-nitrobenzoate.
| Compound Name | [(E)-[amino-(3-sulfanylpyrrolidin-1-yl)methylidene]amino] 4-nitrobenzoate |
|---|---|
| PubChem CID | 88693105 |
| Molecular Formula | C12H14N4O4S |
| Molecular Weight | 310.33 g/mol |
| Exact Mass | 310.07 |
| IUPAC Name | [(E)-[amino-(3-sulfanylpyrrolidin-1-yl)methylidene]amino] 4-nitrobenzoate |
| SMILES | N/C(=N\OC(=O)c1ccc([N+](=O)[O-])cc1)N1CCC(S)C1 |
| InChI | InChI=1S/C12H14N4O4S/c13-12(15-6-5-10(21)7-15)14-20-11(17)8-1-3-9(4-2-8)16(18)19/h1-4,10,21H,5-7H2,(H2,13,14) |
| InChIKey | MIYYFPUXLYJBAV-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 111.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.33 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|