C14H17N3O4S — CID 53395279
[3-(4-nitrophenyl)-1-(3-sulfanylpyrrolidin-1-yl)propylidene]carbamic acid (PubChem CID 53395279) has the molecular formula C14H17N3O4S and a molecular weight of 323.37 g/mol. Its IUPAC name is [3-(4-nitrophenyl)-1-(3-sulfanylpyrrolidin-1-yl)propylidene]carbamic acid.
| Compound Name | [3-(4-nitrophenyl)-1-(3-sulfanylpyrrolidin-1-yl)propylidene]carbamic acid |
|---|---|
| PubChem CID | 53395279 |
| Molecular Formula | C14H17N3O4S |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | [3-(4-nitrophenyl)-1-(3-sulfanylpyrrolidin-1-yl)propylidene]carbamic acid |
| SMILES | O=C(O)N=C(CCc1ccc([N+](=O)[O-])cc1)N1CCC(S)C1 |
| InChI | InChI=1S/C14H17N3O4S/c18-14(19)15-13(16-8-7-12(22)9-16)6-3-10-1-4-11(5-2-10)17(20)21/h1-2,4-5,12,22H,3,6-9H2,(H,18,19) |
| InChIKey | FXBWZCNLNFGWLR-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 96.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|