C26H31N3O4 — CID 2840799
[[(dicyclohexylamino)-(4-nitrophenyl)methylidene]amino] benzoate (PubChem CID 2840799) has the molecular formula C26H31N3O4 and a molecular weight of 449.55 g/mol. Its IUPAC name is [[(dicyclohexylamino)-(4-nitrophenyl)methylidene]amino] benzoate.
| Compound Name | [[(dicyclohexylamino)-(4-nitrophenyl)methylidene]amino] benzoate |
|---|---|
| PubChem CID | 2840799 |
| Molecular Formula | C26H31N3O4 |
| Molecular Weight | 449.55 g/mol |
| Exact Mass | 449.23 |
| IUPAC Name | [[(dicyclohexylamino)-(4-nitrophenyl)methylidene]amino] benzoate |
| SMILES | O=C(ON=C(c1ccc([N+](=O)[O-])cc1)N(C1CCCCC1)C1CCCCC1)c1ccccc1 |
| InChI | InChI=1S/C26H31N3O4/c30-26(21-10-4-1-5-11-21)33-27-25(20-16-18-24(19-17-20)29(31)32)28(22-12-6-2-7-13-22)23-14-8-3-9-15-23/h1,4-5,10-11,16-19,22-23H,2-3,6-9,12-15H2 |
| InChIKey | FEUVVTKJCBNJEB-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 85.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.55 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|