C17H22O4 — CID 69200136
(2-ethoxycarbonyl-2-methylcyclopentyl) 3-methylbenzoate (PubChem CID 69200136) has the molecular formula C17H22O4 and a molecular weight of 290.36 g/mol. Its IUPAC name is (2-ethoxycarbonyl-2-methylcyclopentyl) 3-methylbenzoate.
| Compound Name | (2-ethoxycarbonyl-2-methylcyclopentyl) 3-methylbenzoate |
|---|---|
| PubChem CID | 69200136 |
| Molecular Formula | C17H22O4 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | (2-ethoxycarbonyl-2-methylcyclopentyl) 3-methylbenzoate |
| SMILES | CCOC(=O)C1(C)CCCC1OC(=O)c1cccc(C)c1 |
| InChI | InChI=1S/C17H22O4/c1-4-20-16(19)17(3)10-6-9-14(17)21-15(18)13-8-5-7-12(2)11-13/h5,7-8,11,14H,4,6,9-10H2,1-3H3 |
| InChIKey | WEUZKZCNLCGILK-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |