C18H26O2 — CID 91524771
[2-methyl-2-(2-methylpropyl)cyclopentyl] 3-methylbenzoate (PubChem CID 91524771) has the molecular formula C18H26O2 and a molecular weight of 274.40 g/mol. Its IUPAC name is [2-methyl-2-(2-methylpropyl)cyclopentyl] 3-methylbenzoate.
| Compound Name | [2-methyl-2-(2-methylpropyl)cyclopentyl] 3-methylbenzoate |
|---|---|
| PubChem CID | 91524771 |
| Molecular Formula | C18H26O2 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | [2-methyl-2-(2-methylpropyl)cyclopentyl] 3-methylbenzoate |
| SMILES | Cc1cccc(C(=O)OC2CCCC2(C)CC(C)C)c1 |
| InChI | InChI=1S/C18H26O2/c1-13(2)12-18(4)10-6-9-16(18)20-17(19)15-8-5-7-14(3)11-15/h5,7-8,11,13,16H,6,9-10,12H2,1-4H3 |
| InChIKey | XHWUSJKWQCIFFK-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |